C25H38N8O2 — CID 142825151
4-[methyl-[4-(5-pentyl-2-pyridinyl)piperazin-1-yl]amino]oxy-1-pyrimidin-2-ylpiperidine-4-carboxamide (PubChem CID 142825151) has the molecular formula C25H38N8O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 4-[methyl-[4-(5-pentyl-2-pyridinyl)piperazin-1-yl]amino]oxy-1-pyrimidin-2-ylpiperidine-4-carboxamide.
| Compound Name | 4-[methyl-[4-(5-pentyl-2-pyridinyl)piperazin-1-yl]amino]oxy-1-pyrimidin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142825151 |
| Molecular Formula | C25H38N8O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 4-[methyl-[4-(5-pentyl-2-pyridinyl)piperazin-1-yl]amino]oxy-1-pyrimidin-2-ylpiperidine-4-carboxamide |
| SMILES | CCCCCc1ccc(N2CCN(N(C)OC3(C(N)=O)CCN(c4ncccn4)CC3)CC2)nc1 |
| InChI | InChI=1S/C25H38N8O2/c1-3-4-5-7-21-8-9-22(29-20-21)31-16-18-33(19-17-31)30(2)35-25(23(26)34)10-14-32(15-11-25)24-27-12-6-13-28-24/h6,8-9,12-13,20H,3-5,7,10-11,14-19H2,1-2H3,(H2,26,34) |
| InChIKey | GXYVRFQFNJWKCH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|