C18H28N6O2 — CID 167439824
tert-butyl 4-[5-(4-azidobutyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 167439824) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is tert-butyl 4-[5-(4-azidobutyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(4-azidobutyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167439824 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | tert-butyl 4-[5-(4-azidobutyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CCCCN=[N+]=[N-])cn2)CC1 |
| InChI | InChI=1S/C18H28N6O2/c1-18(2,3)26-17(25)24-12-10-23(11-13-24)16-8-7-15(14-20-16)6-4-5-9-21-22-19/h7-8,14H,4-6,9-13H2,1-3H3 |
| InChIKey | CJICYXQVSYIYMG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 94.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|