C21H28F3N3O2 — CID 142826952
[5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone (PubChem CID 142826952) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is [5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone.
| Compound Name | [5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone |
|---|---|
| PubChem CID | 142826952 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | [5-amino-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone |
| SMILES | Nc1cc(C(F)(F)F)cc2c1CCN(C(=O)C1CCC(NC3CCOCC3)C1)C2 |
| InChI | InChI=1S/C21H28F3N3O2/c22-21(23,24)15-9-14-12-27(6-3-18(14)19(25)11-15)20(28)13-1-2-17(10-13)26-16-4-7-29-8-5-16/h9,11,13,16-17,26H,1-8,10,12,25H2 |
| InChIKey | NQHHAUZTLNQUQV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|