C21H26F3N3O4 — CID 142827013
[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone (PubChem CID 142827013) has the molecular formula C21H26F3N3O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is [5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone.
| Compound Name | [5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone |
|---|---|
| PubChem CID | 142827013 |
| Molecular Formula | C21H26F3N3O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[3-(oxan-4-ylamino)cyclopentyl]methanone |
| SMILES | O=C(C1CCC(NC2CCOCC2)C1)N1CCc2c(cc(C(F)(F)F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H26F3N3O4/c22-21(23,24)15-9-14-12-26(6-3-18(14)19(11-15)27(29)30)20(28)13-1-2-17(10-13)25-16-4-7-31-8-5-16/h9,11,13,16-17,25H,1-8,10,12H2 |
| InChIKey | GKEIDOFBTKPUON-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|