C27H37F6N3O5 — CID 142827095
ethane;2,2,2-trifluoro-N-[3-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclopentyl]-N-(oxan-4-yl)acetamide (PubChem CID 142827095) has the molecular formula C27H37F6N3O5 and a molecular weight of 597.60 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-N-[3-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclopentyl]-N-(oxan-4-yl)acetamide.
| Compound Name | ethane;2,2,2-trifluoro-N-[3-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclopentyl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 142827095 |
| Molecular Formula | C27H37F6N3O5 |
| Molecular Weight | 597.60 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | ethane;2,2,2-trifluoro-N-[3-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]cyclopentyl]-N-(oxan-4-yl)acetamide |
| SMILES | CC.CC.O=C(C1CCC(N(C(=O)C(F)(F)F)C2CCOCC2)C1)N1CCc2c(cc(C(F)(F)F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H25F6N3O5.2C2H6/c24-22(25,26)15-9-14-12-30(6-3-18(14)19(11-15)32(35)36)20(33)13-1-2-17(10-13)31(21(34)23(27,28)29)16-4-7-37-8-5-16;2*1-2/h9,11,13,16-17H,1-8,10,12H2;2*1-2H3 |
| InChIKey | HBWOKVRBPHLCEM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|