C28H34N4O2S — CID 142829443
N-[(2R)-3-(4-methylphenyl)-1-oxo-1-[4-[2-[(2-thiophen-2-ylethylamino)methyl]phenyl]piperazin-1-yl]propan-2-yl]formamide (PubChem CID 142829443) has the molecular formula C28H34N4O2S and a molecular weight of 490.67 g/mol. Its IUPAC name is N-[(2R)-3-(4-methylphenyl)-1-oxo-1-[4-[2-[(2-thiophen-2-ylethylamino)methyl]phenyl]piperazin-1-yl]propan-2-yl]formamide.
| Compound Name | N-[(2R)-3-(4-methylphenyl)-1-oxo-1-[4-[2-[(2-thiophen-2-ylethylamino)methyl]phenyl]piperazin-1-yl]propan-2-yl]formamide |
|---|---|
| PubChem CID | 142829443 |
| Molecular Formula | C28H34N4O2S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[(2R)-3-(4-methylphenyl)-1-oxo-1-[4-[2-[(2-thiophen-2-ylethylamino)methyl]phenyl]piperazin-1-yl]propan-2-yl]formamide |
| SMILES | Cc1ccc(C[C@@H](NC=O)C(=O)N2CCN(c3ccccc3CNCCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C28H34N4O2S/c1-22-8-10-23(11-9-22)19-26(30-21-33)28(34)32-16-14-31(15-17-32)27-7-3-2-5-24(27)20-29-13-12-25-6-4-18-35-25/h2-11,18,21,26,29H,12-17,19-20H2,1H3,(H,30,33)/t26-/m1/s1 |
| InChIKey | QHGJVDSFLSCEBR-AREMUKBSSA-N |
| XLogP | 3.39 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|