C27H32O8S2 — CID 142829606
[(2R,3R,4R,5R)-6-benzylsulfanyl-1,2,4,5-tetrahydroxy-6-phenylmethoxyhexan-3-yl] 4-methylbenzenesulfonate (PubChem CID 142829606) has the molecular formula C27H32O8S2 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-6-benzylsulfanyl-1,2,4,5-tetrahydroxy-6-phenylmethoxyhexan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5R)-6-benzylsulfanyl-1,2,4,5-tetrahydroxy-6-phenylmethoxyhexan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142829606 |
| Molecular Formula | C27H32O8S2 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | [(2R,3R,4R,5R)-6-benzylsulfanyl-1,2,4,5-tetrahydroxy-6-phenylmethoxyhexan-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]([C@H](O)[C@@H](O)C(OCc2ccccc2)SCc2ccccc2)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C27H32O8S2/c1-19-12-14-22(15-13-19)37(32,33)35-26(23(29)16-28)24(30)25(31)27(34-17-20-8-4-2-5-9-20)36-18-21-10-6-3-7-11-21/h2-15,23-31H,16-18H2,1H3/t23-,24-,25-,26-,27?/m1/s1 |
| InChIKey | HZKWTRUMNCRGII-OGJKZRMOSA-N |
| XLogP | 2.62 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|