C23H20FIN2O3 — CID 142834449
ethyl 3-(4-fluorobenzoyl)-8-iodo-1-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 142834449) has the molecular formula C23H20FIN2O3 and a molecular weight of 518.33 g/mol. Its IUPAC name is ethyl 3-(4-fluorobenzoyl)-8-iodo-1-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | ethyl 3-(4-fluorobenzoyl)-8-iodo-1-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 142834449 |
| Molecular Formula | C23H20FIN2O3 |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | ethyl 3-(4-fluorobenzoyl)-8-iodo-1-methyl-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CCOC(=O)C1=CN(C(=O)c2ccc(F)cc2)CC(C)c2c1[nH]c1cc(I)ccc21 |
| InChI | InChI=1S/C23H20FIN2O3/c1-3-30-23(29)18-12-27(22(28)14-4-6-15(24)7-5-14)11-13(2)20-17-9-8-16(25)10-19(17)26-21(18)20/h4-10,12-13,26H,3,11H2,1-2H3 |
| InChIKey | NBABCUZSYLPTDP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|