C19H16F2N4O2 — CID 142836253
3-[(E)-2-(3,4-difluorophenyl)ethenyl]-N-(2-iminoethyl)-4-methoxy-1H-indazole-5-carboxamide (PubChem CID 142836253) has the molecular formula C19H16F2N4O2 and a molecular weight of 370.36 g/mol. Its IUPAC name is 3-[(E)-2-(3,4-difluorophenyl)ethenyl]-N-(2-iminoethyl)-4-methoxy-1H-indazole-5-carboxamide.
| Compound Name | 3-[(E)-2-(3,4-difluorophenyl)ethenyl]-N-(2-iminoethyl)-4-methoxy-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 142836253 |
| Molecular Formula | C19H16F2N4O2 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 3-[(E)-2-(3,4-difluorophenyl)ethenyl]-N-(2-iminoethyl)-4-methoxy-1H-indazole-5-carboxamide |
| SMILES | [H]/N=C/CNC(=O)c1ccc2[nH]nc(/C=C/c3ccc(F)c(F)c3)c2c1OC |
| InChI | InChI=1S/C19H16F2N4O2/c1-27-18-12(19(26)23-9-8-22)4-7-16-17(18)15(24-25-16)6-3-11-2-5-13(20)14(21)10-11/h2-8,10,22H,9H2,1H3,(H,23,26)(H,24,25)/b6-3+,22-8+ |
| InChIKey | IICQZVVZAXIXMQ-WCCUNCDVSA-N |
| XLogP | 3.40 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|