C24H21N3O3S — CID 72564465
3-[2-(4-acetylphenyl)ethenyl]-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide (PubChem CID 72564465) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-[2-(4-acetylphenyl)ethenyl]-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-[2-(4-acetylphenyl)ethenyl]-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 72564465 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[2-(4-acetylphenyl)ethenyl]-4-methoxy-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide |
| SMILES | COc1c(C(=O)NCc2cccs2)ccc2[nH]nc(C=Cc3ccc(C(C)=O)cc3)c12 |
| InChI | InChI=1S/C24H21N3O3S/c1-15(28)17-8-5-16(6-9-17)7-11-20-22-21(27-26-20)12-10-19(23(22)30-2)24(29)25-14-18-4-3-13-31-18/h3-13H,14H2,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | QOBKIVOXMJPVMO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |