C30H35N3O4S3 — CID 142837087
N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentanecarboxamide;N-[1-[5-[(1E,3Z)-4-sulfanylbuta-1,3-dienyl]thiophen-2-yl]ethyl]formamide (PubChem CID 142837087) has the molecular formula C30H35N3O4S3 and a molecular weight of 597.83 g/mol. Its IUPAC name is N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentanecarboxamide;N-[1-[5-[(1E,3Z)-4-sulfanylbuta-1,3-dienyl]thiophen-2-yl]ethyl]formamide.
| Compound Name | N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentanecarboxamide;N-[1-[5-[(1E,3Z)-4-sulfanylbuta-1,3-dienyl]thiophen-2-yl]ethyl]formamide |
|---|---|
| PubChem CID | 142837087 |
| Molecular Formula | C30H35N3O4S3 |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | N-[[4-(2-sulfamoylphenyl)phenyl]methyl]cyclopentanecarboxamide;N-[1-[5-[(1E,3Z)-4-sulfanylbuta-1,3-dienyl]thiophen-2-yl]ethyl]formamide |
| SMILES | CC(NC=O)c1ccc(/C=C/C=C\S)s1.NS(=O)(=O)c1ccccc1-c1ccc(CNC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H22N2O3S.C11H13NOS2/c20-25(23,24)18-8-4-3-7-17(18)15-11-9-14(10-12-15)13-21-19(22)16-5-1-2-6-16;1-9(12-8-13)11-6-5-10(15-11)4-2-3-7-14/h3-4,7-12,16H,1-2,5-6,13H2,(H,21,22)(H2,20,23,24);2-9,14H,1H3,(H,12,13)/b;4-2+,7-3- |
| InChIKey | WGXMYUOCXINEBR-MNRHONDPSA-N |
| XLogP | 5.82 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|