C19H19F2N3 — CID 142838158
(Z)-N-[(Z)-ethylideneamino]-1,3-bis(4-fluorophenyl)-N-methyl-3-methyliminoprop-1-en-1-amine (PubChem CID 142838158) has the molecular formula C19H19F2N3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (Z)-N-[(Z)-ethylideneamino]-1,3-bis(4-fluorophenyl)-N-methyl-3-methyliminoprop-1-en-1-amine.
| Compound Name | (Z)-N-[(Z)-ethylideneamino]-1,3-bis(4-fluorophenyl)-N-methyl-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 142838158 |
| Molecular Formula | C19H19F2N3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (Z)-N-[(Z)-ethylideneamino]-1,3-bis(4-fluorophenyl)-N-methyl-3-methyliminoprop-1-en-1-amine |
| SMILES | C/C=N\N(C)/C(=C\C(=N\C)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2N3/c1-4-23-24(3)19(15-7-11-17(21)12-8-15)13-18(22-2)14-5-9-16(20)10-6-14/h4-13H,1-3H3/b19-13-,22-18-,23-4- |
| InChIKey | GPXLRRILGXSSEA-NJSIFUPZSA-N |
| XLogP | 4.36 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|