C15H22N2 — CID 142838375
N,2-diethylisoquinolin-3-imine;ethane (PubChem CID 142838375) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N,2-diethylisoquinolin-3-imine;ethane.
| Compound Name | N,2-diethylisoquinolin-3-imine;ethane |
|---|---|
| PubChem CID | 142838375 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N,2-diethylisoquinolin-3-imine;ethane |
| SMILES | CC.CC/N=c1\cc2ccccc2cn1CC |
| InChI | InChI=1S/C13H16N2.C2H6/c1-3-14-13-9-11-7-5-6-8-12(11)10-15(13)4-2;1-2/h5-10H,3-4H2,1-2H3;1-2H3/b14-13+; |
| InChIKey | KXIFKQRGLLTDEF-IERUDJENSA-N |
| XLogP | 3.61 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |