C9H16N4 — CID 142838730
methanamine;2,5,6-trimethylpyridine-3,4-diimine (PubChem CID 142838730) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is methanamine;2,5,6-trimethylpyridine-3,4-diimine.
| Compound Name | methanamine;2,5,6-trimethylpyridine-3,4-diimine |
|---|---|
| PubChem CID | 142838730 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | methanamine;2,5,6-trimethylpyridine-3,4-diimine |
| SMILES | CN.[H]/N=C1\C(C)=NC(C)=C(C)\C1=N\[H] |
| InChI | InChI=1S/C8H11N3.CH5N/c1-4-5(2)11-6(3)8(10)7(4)9;1-2/h9-10H,1-3H3;2H2,1H3/b9-7-,10-8+; |
| InChIKey | HYLXIAZJPIGSAR-OMINISFASA-N |
| XLogP | 1.37 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|