C10H15N3 — CID 144670654
3-N,4-N,2,5,6-pentamethylpyridine-3,4-diimine (PubChem CID 144670654) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-N,4-N,2,5,6-pentamethylpyridine-3,4-diimine.
| Compound Name | 3-N,4-N,2,5,6-pentamethylpyridine-3,4-diimine |
|---|---|
| PubChem CID | 144670654 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-N,4-N,2,5,6-pentamethylpyridine-3,4-diimine |
| SMILES | C/N=C1/C(C)=C(C)N=C(C)/C1=N\C |
| InChI | InChI=1S/C10H15N3/c1-6-7(2)13-8(3)10(12-5)9(6)11-4/h1-5H3/b11-9-,12-10+ |
| InChIKey | WXSGXONSBNTCBT-DSOJMZEYSA-N |
| XLogP | 1.90 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|