C12H18N2 — CID 22979280
1-N,2-N,3,4,5,6-hexamethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 22979280) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-N,2-N,3,4,5,6-hexamethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N,3,4,5,6-hexamethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 22979280 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-N,2-N,3,4,5,6-hexamethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1\C(C)=C(C)C(C)=C(C)\C1=N/C |
| InChI | InChI=1S/C12H18N2/c1-7-8(2)10(4)12(14-6)11(13-5)9(7)3/h1-6H3/b13-11+,14-12+ |
| InChIKey | VOINLPBASCPOSE-PHEQNACWSA-N |
| XLogP | 2.81 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|