About (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol
(3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol (PubChem CID 142838942) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol.
Molecular Properties
| Compound Name | (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol |
| PubChem CID | 142838942 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol |
| SMILES | CC[C@@H](O)C(C)CN(C)C.Oc1ccccc1 |
| InChI | InChI=1S/C8H19NO.C6H6O/c1-5-8(10)7(2)6-9(3)4;7-6-4-2-1-3-5-6/h7-8,10H,5-6H2,1-4H3;1-5,7H/t7?,8-;/m1./s1 |
| InChIKey | NHBBRVHEFBANCT-LTTWWRRRSA-N |
| XLogP | 2.35 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol?
The IUPAC name of (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol (CID 142838942) is (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol.
What is the SMILES notation for (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol?
The canonical SMILES for (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol is CC[C@@H](O)C(C)CN(C)C.Oc1ccccc1.
What is the InChIKey of (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol?
The InChIKey is NHBBRVHEFBANCT-LTTWWRRRSA-N. The full InChI is InChI=1S/C8H19NO.C6H6O/c1-5-8(10)7(2)6-9(3)4;7-6-4-2-1-3-5-6/h7-8,10H,5-6H2,1-4H3;1-5,7H/t7?,8-;/m1./s1.
What are the key properties of (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol?
(3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol has a molecular weight of 239.36 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(dimethylamino)-2-methylpentan-3-ol;phenol is sourced from PubChem (CID 142838942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).