C7H12FNO2S — CID 142839137
fluoro (3S)-2,2-dimethylthiomorpholine-3-carboxylate (PubChem CID 142839137) has the molecular formula C7H12FNO2S and a molecular weight of 193.24 g/mol. Its IUPAC name is fluoro (3S)-2,2-dimethylthiomorpholine-3-carboxylate.
| Compound Name | fluoro (3S)-2,2-dimethylthiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 142839137 |
| Molecular Formula | C7H12FNO2S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | fluoro (3S)-2,2-dimethylthiomorpholine-3-carboxylate |
| SMILES | CC1(C)SCCN[C@H]1C(=O)OF |
| InChI | InChI=1S/C7H12FNO2S/c1-7(2)5(6(10)11-8)9-3-4-12-7/h5,9H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | AQKAVEFSMIUYRY-YFKPBYRVSA-N |
| XLogP | 0.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |