fluoro 2,2-dimethylthiomorpholine-3-carboxylate

C7H12FNO2S — CID 142839139

IUPACfluoro 2,2-dimethylthiomorpholine-3-carboxylate
SMILESCC1(C)SCCNC1C(=O)OF
InChIInChI=1S/C7H12FNO2S/c1-7(2)5(6(10)11-8)9-3-4-12-7/h5,9H,3-4H2,1-2H3
InChIKeyAQKAVEFSMIUYRY-UHFFFAOYSA-N
MW193.24 g/mol
LogP0.90
Rot. Bonds1

About fluoro 2,2-dimethylthiomorpholine-3-carboxylate

fluoro 2,2-dimethylthiomorpholine-3-carboxylate (PubChem CID 142839139) has the molecular formula C7H12FNO2S and a molecular weight of 193.24 g/mol. Its IUPAC name is fluoro 2,2-dimethylthiomorpholine-3-carboxylate.

Molecular Properties

Compound Namefluoro 2,2-dimethylthiomorpholine-3-carboxylate
PubChem CID142839139
Molecular FormulaC7H12FNO2S
Molecular Weight193.24 g/mol
Exact Mass193.06
IUPAC Namefluoro 2,2-dimethylthiomorpholine-3-carboxylate
SMILESCC1(C)SCCNC1C(=O)OF
InChIInChI=1S/C7H12FNO2S/c1-7(2)5(6(10)11-8)9-3-4-12-7/h5,9H,3-4H2,1-2H3
InChIKeyAQKAVEFSMIUYRY-UHFFFAOYSA-N
XLogP0.90
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.24
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze fluoro 2,2-dimethylthiomorpholine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoro 2,2-dimethylthiomorpholine-3-carboxylate?
The IUPAC name of fluoro 2,2-dimethylthiomorpholine-3-carboxylate (CID 142839139) is fluoro 2,2-dimethylthiomorpholine-3-carboxylate.
What is the SMILES notation for fluoro 2,2-dimethylthiomorpholine-3-carboxylate?
The canonical SMILES for fluoro 2,2-dimethylthiomorpholine-3-carboxylate is CC1(C)SCCNC1C(=O)OF.
What is the InChIKey of fluoro 2,2-dimethylthiomorpholine-3-carboxylate?
The InChIKey is AQKAVEFSMIUYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FNO2S/c1-7(2)5(6(10)11-8)9-3-4-12-7/h5,9H,3-4H2,1-2H3.
What are the key properties of fluoro 2,2-dimethylthiomorpholine-3-carboxylate?
fluoro 2,2-dimethylthiomorpholine-3-carboxylate has a molecular weight of 193.24 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2,2-dimethylthiomorpholine-3-carboxylate is sourced from PubChem (CID 142839139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).