About 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate
2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate (PubChem CID 142839715) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate.
Analyze 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate?
The IUPAC name of 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate (CID 142839715) is 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate.
What is the SMILES notation for 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate?
The canonical SMILES for 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate is CS(=O)CC1=CCCC=C1.O.
What is the InChIKey of 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate?
The InChIKey is QLOVKRRHTDAQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS.H2O/c1-10(9)7-8-5-3-2-4-6-8;/h3,5-6H,2,4,7H2,1H3;1H2.
What are the key properties of 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate?
2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate has a molecular weight of 174.26 g/mol, XLogP of 0.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylsulfinylmethyl)cyclohexa-1,3-diene;hydrate is sourced from PubChem (CID 142839715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).