C21H37NO2 — CID 142840946
buta-1,3-diene;1-ethyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one;prop-1-ene (PubChem CID 142840946) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is buta-1,3-diene;1-ethyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one;prop-1-ene.
| Compound Name | buta-1,3-diene;1-ethyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one;prop-1-ene |
|---|---|
| PubChem CID | 142840946 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | buta-1,3-diene;1-ethyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one;prop-1-ene |
| SMILES | C=CC.C=CC=C.CCCCCC(O)/C=C/C1CCC(=O)N1CC |
| InChI | InChI=1S/C14H25NO2.C4H6.C3H6/c1-3-5-6-7-13(16)10-8-12-9-11-14(17)15(12)4-2;1-3-4-2;1-3-2/h8,10,12-13,16H,3-7,9,11H2,1-2H3;3-4H,1-2H2;3H,1H2,2H3/b10-8+;; |
| InChIKey | DGDKUFDZJUIIHG-PIHABLKOSA-N |
| XLogP | 5.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|