C24H45NO — CID 142840999
1-ethyl-5-[(E)-7-methyloct-1-enyl]pyrrolidin-2-one;2-methylprop-1-ene;(Z)-pent-2-ene (PubChem CID 142840999) has the molecular formula C24H45NO and a molecular weight of 363.63 g/mol. Its IUPAC name is 1-ethyl-5-[(E)-7-methyloct-1-enyl]pyrrolidin-2-one;2-methylprop-1-ene;(Z)-pent-2-ene.
| Compound Name | 1-ethyl-5-[(E)-7-methyloct-1-enyl]pyrrolidin-2-one;2-methylprop-1-ene;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 142840999 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | 1-ethyl-5-[(E)-7-methyloct-1-enyl]pyrrolidin-2-one;2-methylprop-1-ene;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.C=C(C)C.CCN1C(=O)CCC1/C=C/CCCCC(C)C |
| InChI | InChI=1S/C15H27NO.C5H10.C4H8/c1-4-16-14(11-12-15(16)17)10-8-6-5-7-9-13(2)3;1-3-5-4-2;1-4(2)3/h8,10,13-14H,4-7,9,11-12H2,1-3H3;3,5H,4H2,1-2H3;1H2,2-3H3/b10-8+;5-3-; |
| InChIKey | CBUPIYMOOHZLCG-CJZZLVIBSA-N |
| XLogP | 7.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|