C16H25NO — CID 14223619
[(1S)-1,2-dimethylcyclohexa-2,5-dien-1-yl]-[(2R)-2-propylpyrrolidin-1-yl]methanone (PubChem CID 14223619) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is [(1S)-1,2-dimethylcyclohexa-2,5-dien-1-yl]-[(2R)-2-propylpyrrolidin-1-yl]methanone.
| Compound Name | [(1S)-1,2-dimethylcyclohexa-2,5-dien-1-yl]-[(2R)-2-propylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 14223619 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | [(1S)-1,2-dimethylcyclohexa-2,5-dien-1-yl]-[(2R)-2-propylpyrrolidin-1-yl]methanone |
| SMILES | CCC[C@@H]1CCCN1C(=O)[C@@]1(C)C=CCC=C1C |
| InChI | InChI=1S/C16H25NO/c1-4-8-14-10-7-12-17(14)15(18)16(3)11-6-5-9-13(16)2/h6,9,11,14H,4-5,7-8,10,12H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | ZDZRRNYVUIEOSH-ZBFHGGJFSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|