C21H30N2O — CID 142841852
(E)-4-methyl-1-(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)hept-4-en-3-one (PubChem CID 142841852) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (E)-4-methyl-1-(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)hept-4-en-3-one.
| Compound Name | (E)-4-methyl-1-(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)hept-4-en-3-one |
|---|---|
| PubChem CID | 142841852 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (E)-4-methyl-1-(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)hept-4-en-3-one |
| SMILES | CC/C=C(\C)C(=O)CCN1CCC2(CC1)CN(C)c1ccccc12 |
| InChI | InChI=1S/C21H30N2O/c1-4-7-17(2)20(24)10-13-23-14-11-21(12-15-23)16-22(3)19-9-6-5-8-18(19)21/h5-9H,4,10-16H2,1-3H3/b17-7+ |
| InChIKey | ZJWPZIHSAICRPX-REZTVBANSA-N |
| XLogP | 3.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|