C14H13NS — CID 142842300
7-methyl-3,10-dihydrocyclohepta[b][1,4]benzothiazine (PubChem CID 142842300) has the molecular formula C14H13NS and a molecular weight of 227.33 g/mol. Its IUPAC name is 7-methyl-3,10-dihydrocyclohepta[b][1,4]benzothiazine.
| Compound Name | 7-methyl-3,10-dihydrocyclohepta[b][1,4]benzothiazine |
|---|---|
| PubChem CID | 142842300 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 7-methyl-3,10-dihydrocyclohepta[b][1,4]benzothiazine |
| SMILES | CC1=CC2=C(CC=C1)N=C1C=CCC=C1S2 |
| InChI | InChI=1S/C14H13NS/c1-10-5-4-7-12-14(9-10)16-13-8-3-2-6-11(13)15-12/h2,4-6,8-9H,3,7H2,1H3 |
| InChIKey | IJPGHQGTMWHOJI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |