C14H13NS — CID 142809452
6-(7H-cyclohepta[b]thiophen-2-yl)-2,3-dihydropyridine (PubChem CID 142809452) has the molecular formula C14H13NS and a molecular weight of 227.33 g/mol. Its IUPAC name is 6-(7H-cyclohepta[b]thiophen-2-yl)-2,3-dihydropyridine.
| Compound Name | 6-(7H-cyclohepta[b]thiophen-2-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 142809452 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-(7H-cyclohepta[b]thiophen-2-yl)-2,3-dihydropyridine |
| SMILES | C1=CCC=c2sc(C3=NCCC=C3)cc2=C1 |
| InChI | InChI=1S/C14H13NS/c1-2-6-11-10-14(16-13(11)8-3-1)12-7-4-5-9-15-12/h1-2,4,6-8,10H,3,5,9H2 |
| InChIKey | COXVWCXEQMPNOV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |