C9H9NS — CID 14174473
2,3-dihydrocyclohepta[b][1,4]thiazine (PubChem CID 14174473) has the molecular formula C9H9NS and a molecular weight of 163.25 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[b][1,4]thiazine.
| Compound Name | 2,3-dihydrocyclohepta[b][1,4]thiazine |
|---|---|
| PubChem CID | 14174473 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 2,3-dihydrocyclohepta[b][1,4]thiazine |
| SMILES | C1=CC=C2SCCN=C2C=C1 |
| InChI | InChI=1S/C9H9NS/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-5H,6-7H2 |
| InChIKey | FAYDOVHHJBDZGN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |