C9H13NS — CID 123528853
N-methyl-5-methylsulfanylhepta-1,4,6-trien-3-imine (PubChem CID 123528853) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N-methyl-5-methylsulfanylhepta-1,4,6-trien-3-imine.
| Compound Name | N-methyl-5-methylsulfanylhepta-1,4,6-trien-3-imine |
|---|---|
| PubChem CID | 123528853 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-methyl-5-methylsulfanylhepta-1,4,6-trien-3-imine |
| SMILES | C=CC(=C/C(C=C)=N/C)SC |
| InChI | InChI=1S/C9H13NS/c1-5-8(10-3)7-9(6-2)11-4/h5-7H,1-2H2,3-4H3/b9-7?,10-8+ |
| InChIKey | VIDZNYKFVFMCTO-LSVQJBSPSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|