C7H11NS — CID 20761822
5,7-dimethyl-2,3-dihydro-1,4-thiazepine (PubChem CID 20761822) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 5,7-dimethyl-2,3-dihydro-1,4-thiazepine.
| Compound Name | 5,7-dimethyl-2,3-dihydro-1,4-thiazepine |
|---|---|
| PubChem CID | 20761822 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 5,7-dimethyl-2,3-dihydro-1,4-thiazepine |
| SMILES | CC1=CC(C)=NCCS1 |
| InChI | InChI=1S/C7H11NS/c1-6-5-7(2)9-4-3-8-6/h5H,3-4H2,1-2H3 |
| InChIKey | AYFXQUADICHETK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |