C25H23N3O7S — CID 142842404
4-nitro-N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene (PubChem CID 142842404) has the molecular formula C25H23N3O7S and a molecular weight of 509.54 g/mol. Its IUPAC name is 4-nitro-N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene.
| Compound Name | 4-nitro-N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene |
|---|---|
| PubChem CID | 142842404 |
| Molecular Formula | C25H23N3O7S |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 4-nitro-N-[4-[(E)-3-oxo-3-(2-oxo-1,3-oxazolidin-3-yl)prop-1-enyl]phenyl]benzenesulfonamide;toluene |
| SMILES | Cc1ccccc1.O=C(/C=C/c1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)N1CCOC1=O |
| InChI | InChI=1S/C18H15N3O7S.C7H8/c22-17(20-11-12-28-18(20)23)10-3-13-1-4-14(5-2-13)19-29(26,27)16-8-6-15(7-9-16)21(24)25;1-7-5-3-2-4-6-7/h1-10,19H,11-12H2;2-6H,1H3/b10-3+; |
| InChIKey | HRKCGBDUGWOIHV-ORVWSRSGSA-N |
| XLogP | 4.38 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|