C22H16FN5O9S2 — CID 166475358
N-[(4-fluorophenyl)-(4-nitrophenyl)sulfonylimino-(2-oxo-1,3-oxazolidin-3-yl)-λ6-sulfanylidene]-4-nitrobenzamide (PubChem CID 166475358) has the molecular formula C22H16FN5O9S2 and a molecular weight of 577.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(4-nitrophenyl)sulfonylimino-(2-oxo-1,3-oxazolidin-3-yl)-λ6-sulfanylidene]-4-nitrobenzamide.
| Compound Name | N-[(4-fluorophenyl)-(4-nitrophenyl)sulfonylimino-(2-oxo-1,3-oxazolidin-3-yl)-λ6-sulfanylidene]-4-nitrobenzamide |
|---|---|
| PubChem CID | 166475358 |
| Molecular Formula | C22H16FN5O9S2 |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.04 |
| IUPAC Name | N-[(4-fluorophenyl)-(4-nitrophenyl)sulfonylimino-(2-oxo-1,3-oxazolidin-3-yl)-λ6-sulfanylidene]-4-nitrobenzamide |
| SMILES | O=C(N=S(=NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)(c1ccc(F)cc1)N1CCOC1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H16FN5O9S2/c23-16-3-9-19(10-4-16)38(26-13-14-37-22(26)30,24-21(29)15-1-5-17(6-2-15)27(31)32)25-39(35,36)20-11-7-18(8-12-20)28(33)34/h1-12H,13-14H2 |
| InChIKey | KZFDMCVAWWZUEF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 191.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|