C38H56FN3O4 — CID 142843688
5-amino-N-(4-fluorophenyl)-6-formamido-2-methylhexanamide;1-methyl-3,5-di(pentan-3-yloxy)benzene;toluene (PubChem CID 142843688) has the molecular formula C38H56FN3O4 and a molecular weight of 637.88 g/mol. Its IUPAC name is 5-amino-N-(4-fluorophenyl)-6-formamido-2-methylhexanamide;1-methyl-3,5-di(pentan-3-yloxy)benzene;toluene.
| Compound Name | 5-amino-N-(4-fluorophenyl)-6-formamido-2-methylhexanamide;1-methyl-3,5-di(pentan-3-yloxy)benzene;toluene |
|---|---|
| PubChem CID | 142843688 |
| Molecular Formula | C38H56FN3O4 |
| Molecular Weight | 637.88 g/mol |
| Exact Mass | 637.43 |
| IUPAC Name | 5-amino-N-(4-fluorophenyl)-6-formamido-2-methylhexanamide;1-methyl-3,5-di(pentan-3-yloxy)benzene;toluene |
| SMILES | CC(CCC(N)CNC=O)C(=O)Nc1ccc(F)cc1.CCC(CC)Oc1cc(C)cc(OC(CC)CC)c1.Cc1ccccc1 |
| InChI | InChI=1S/C17H28O2.C14H20FN3O2.C7H8/c1-6-14(7-2)18-16-10-13(5)11-17(12-16)19-15(8-3)9-4;1-10(2-5-12(16)8-17-9-19)14(20)18-13-6-3-11(15)4-7-13;1-7-5-3-2-4-6-7/h10-12,14-15H,6-9H2,1-5H3;3-4,6-7,9-10,12H,2,5,8,16H2,1H3,(H,17,19)(H,18,20);2-6H,1H3 |
| InChIKey | PFEVCYCTXMWLJQ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|