C25H25NO4S — CID 142844682
methyl 2-[2-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]ethylsulfanyl]benzoate (PubChem CID 142844682) has the molecular formula C25H25NO4S and a molecular weight of 435.55 g/mol. Its IUPAC name is methyl 2-[2-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]ethylsulfanyl]benzoate.
| Compound Name | methyl 2-[2-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]ethylsulfanyl]benzoate |
|---|---|
| PubChem CID | 142844682 |
| Molecular Formula | C25H25NO4S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl 2-[2-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]ethylsulfanyl]benzoate |
| SMILES | COC(=O)c1ccccc1SCCc1ccc(OCC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO4S/c1-29-25(28)22-9-5-6-10-23(22)31-16-15-19-11-13-21(14-12-19)30-18-24(27)26-17-20-7-3-2-4-8-20/h2-14H,15-18H2,1H3,(H,26,27) |
| InChIKey | BEHJSNRWYGSMPS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |