C22H24F2N2O4 — CID 142845009
3-[4-[2-[4-[4-(difluoromethyl)phenyl]piperazin-1-yl]-2-oxoethoxy]phenyl]propanoic acid (PubChem CID 142845009) has the molecular formula C22H24F2N2O4 and a molecular weight of 418.44 g/mol. Its IUPAC name is 3-[4-[2-[4-[4-(difluoromethyl)phenyl]piperazin-1-yl]-2-oxoethoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-[4-[4-(difluoromethyl)phenyl]piperazin-1-yl]-2-oxoethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142845009 |
| Molecular Formula | C22H24F2N2O4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-[4-[2-[4-[4-(difluoromethyl)phenyl]piperazin-1-yl]-2-oxoethoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC(=O)N2CCN(c3ccc(C(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H24F2N2O4/c23-22(24)17-4-6-18(7-5-17)25-11-13-26(14-12-25)20(27)15-30-19-8-1-16(2-9-19)3-10-21(28)29/h1-2,4-9,22H,3,10-15H2,(H,28,29) |
| InChIKey | OGLASRLWFLVFSC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |