C30H29BrF3N3O3S — CID 142846064
3-[[4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methyl]benzoyl]amino]propanoic acid;1,1,1-trifluoroethane (PubChem CID 142846064) has the molecular formula C30H29BrF3N3O3S and a molecular weight of 648.55 g/mol. Its IUPAC name is 3-[[4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methyl]benzoyl]amino]propanoic acid;1,1,1-trifluoroethane.
| Compound Name | 3-[[4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methyl]benzoyl]amino]propanoic acid;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 142846064 |
| Molecular Formula | C30H29BrF3N3O3S |
| Molecular Weight | 648.55 g/mol |
| Exact Mass | 647.11 |
| IUPAC Name | 3-[[4-[[[4-(4-bromophenyl)-1,3-thiazol-2-yl]-(4-methylcyclohepta-1,3,6-trien-1-yl)amino]methyl]benzoyl]amino]propanoic acid;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CC1=CC=C(N(Cc2ccc(C(=O)NCCC(=O)O)cc2)c2nc(-c3ccc(Br)cc3)cs2)C=CC1 |
| InChI | InChI=1S/C28H26BrN3O3S.C2H3F3/c1-19-3-2-4-24(14-5-19)32(28-31-25(18-36-28)21-10-12-23(29)13-11-21)17-20-6-8-22(9-7-20)27(35)30-16-15-26(33)34;1-2(3,4)5/h2,4-14,18H,3,15-17H2,1H3,(H,30,35)(H,33,34);1H3 |
| InChIKey | IXEJMFHXLBTIAO-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.55 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |