C10H15N3O2 — CID 142846941
6-[dimethylamino(hydroxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 142846941) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 6-[dimethylamino(hydroxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
| Compound Name | 6-[dimethylamino(hydroxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 142846941 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 6-[dimethylamino(hydroxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | CN(C)C(O)C1CCc2nccc(=O)n21 |
| InChI | InChI=1S/C10H15N3O2/c1-12(2)10(15)7-3-4-8-11-6-5-9(14)13(7)8/h5-7,10,15H,3-4H2,1-2H3 |
| InChIKey | LEEHHCYKQQUOKP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|