C19H24FN3O6 — CID 142849089
formic acid;methyl 3-(butylcarbamoyl)-4-(4-fluorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 142849089) has the molecular formula C19H24FN3O6 and a molecular weight of 409.41 g/mol. Its IUPAC name is formic acid;methyl 3-(butylcarbamoyl)-4-(4-fluorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | formic acid;methyl 3-(butylcarbamoyl)-4-(4-fluorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142849089 |
| Molecular Formula | C19H24FN3O6 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | formic acid;methyl 3-(butylcarbamoyl)-4-(4-fluorophenyl)-6-methyl-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCCCNC(=O)N1C(=O)NC(C)=C(C(=O)OC)C1c1ccc(F)cc1.O=CO |
| InChI | InChI=1S/C18H22FN3O4.CH2O2/c1-4-5-10-20-17(24)22-15(12-6-8-13(19)9-7-12)14(16(23)26-3)11(2)21-18(22)25;2-1-3/h6-9,15H,4-5,10H2,1-3H3,(H,20,24)(H,21,25);1H,(H,2,3) |
| InChIKey | HVWBRNLWHQPCTP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|