About nitrocyclohexane
nitrocyclohexane (PubChem CID 14285) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is nitrocyclohexane.
Molecular Properties
| Compound Name | nitrocyclohexane |
| PubChem CID | 14285 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | nitrocyclohexane |
| SMILES | O=[N+]([O-])C1CCCCC1 |
| InChI | InChI=1S/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | NJNQUTDUIPVROZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrocyclohexane?
The IUPAC name of nitrocyclohexane (CID 14285) is nitrocyclohexane.
What is the SMILES notation for nitrocyclohexane?
The canonical SMILES for nitrocyclohexane is O=[N+]([O-])C1CCCCC1.
What is the InChIKey of nitrocyclohexane?
The InChIKey is NJNQUTDUIPVROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2.
What are the key properties of nitrocyclohexane?
nitrocyclohexane has a molecular weight of 129.16 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitrocyclohexane is sourced from PubChem (CID 14285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).