C36H37O9P — CID 142850174
[2-(1,4-dioxan-2-yl)phenyl] [2-(1,3-dioxolan-2-yl)phenyl] [2-(4-methoxy-2-propylbenzoyl)phenyl] phosphite (PubChem CID 142850174) has the molecular formula C36H37O9P and a molecular weight of 644.66 g/mol. Its IUPAC name is [2-(1,4-dioxan-2-yl)phenyl] [2-(1,3-dioxolan-2-yl)phenyl] [2-(4-methoxy-2-propylbenzoyl)phenyl] phosphite.
| Compound Name | [2-(1,4-dioxan-2-yl)phenyl] [2-(1,3-dioxolan-2-yl)phenyl] [2-(4-methoxy-2-propylbenzoyl)phenyl] phosphite |
|---|---|
| PubChem CID | 142850174 |
| Molecular Formula | C36H37O9P |
| Molecular Weight | 644.66 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | [2-(1,4-dioxan-2-yl)phenyl] [2-(1,3-dioxolan-2-yl)phenyl] [2-(4-methoxy-2-propylbenzoyl)phenyl] phosphite |
| SMILES | CCCc1cc(OC)ccc1C(=O)c1ccccc1OP(Oc1ccccc1C1COCCO1)Oc1ccccc1C1OCCO1 |
| InChI | InChI=1S/C36H37O9P/c1-3-10-25-23-26(38-2)17-18-27(25)35(37)29-12-5-8-15-32(29)44-46(45-33-16-9-6-13-30(33)36-41-21-22-42-36)43-31-14-7-4-11-28(31)34-24-39-19-20-40-34/h4-9,11-18,23,34,36H,3,10,19-22,24H2,1-2H3 |
| InChIKey | BSUOVKVTKMUKMX-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|