C32H30O6P2S — CID 142850472
2-(2-hydroxyphenyl)phenol;2-[2-[2-methyl-6-(phosphanyloxymethyl)-4-sulfanylphenoxy]phosphanyloxyphenyl]phenol (PubChem CID 142850472) has the molecular formula C32H30O6P2S and a molecular weight of 604.60 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)phenol;2-[2-[2-methyl-6-(phosphanyloxymethyl)-4-sulfanylphenoxy]phosphanyloxyphenyl]phenol.
| Compound Name | 2-(2-hydroxyphenyl)phenol;2-[2-[2-methyl-6-(phosphanyloxymethyl)-4-sulfanylphenoxy]phosphanyloxyphenyl]phenol |
|---|---|
| PubChem CID | 142850472 |
| Molecular Formula | C32H30O6P2S |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | 2-(2-hydroxyphenyl)phenol;2-[2-[2-methyl-6-(phosphanyloxymethyl)-4-sulfanylphenoxy]phosphanyloxyphenyl]phenol |
| SMILES | Cc1cc(S)cc(COP)c1OPOc1ccccc1-c1ccccc1O.Oc1ccccc1-c1ccccc1O |
| InChI | InChI=1S/C20H20O4P2S.C12H10O2/c1-13-10-15(27)11-14(12-22-25)20(13)24-26-23-19-9-5-3-7-17(19)16-6-2-4-8-18(16)21;13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h2-11,21,26-27H,12,25H2,1H3;1-8,13-14H |
| InChIKey | BONQMUWECOBRCN-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|