C24H26N6O2 — CID 142853037
N-[3-amino-4-(2-methylbutan-2-yl)phenyl]-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyridine-3-carboxamide (PubChem CID 142853037) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[3-amino-4-(2-methylbutan-2-yl)phenyl]-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-[3-amino-4-(2-methylbutan-2-yl)phenyl]-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142853037 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[3-amino-4-(2-methylbutan-2-yl)phenyl]-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]pyridine-3-carboxamide |
| SMILES | CCC(C)(C)c1ccc(NC(=O)c2cccnc2Nc2ccc3[nH]c(=O)[nH]c3c2)cc1N |
| InChI | InChI=1S/C24H26N6O2/c1-4-24(2,3)17-9-7-14(12-18(17)25)28-22(31)16-6-5-11-26-21(16)27-15-8-10-19-20(13-15)30-23(32)29-19/h5-13H,4,25H2,1-3H3,(H,26,27)(H,28,31)(H2,29,30,32) |
| InChIKey | UIBMFLUWYIIYPK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|