C15H20F5NO — CID 142853190
2-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxymethyl]pyrrolidine (PubChem CID 142853190) has the molecular formula C15H20F5NO and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxymethyl]pyrrolidine.
| Compound Name | 2-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 142853190 |
| Molecular Formula | C15H20F5NO |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[[1,5-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-yl]oxymethyl]pyrrolidine |
| SMILES | CC1=CC=C(C(F)(F)C(F)(F)F)C(C)(OCC2CCCN2)C1 |
| InChI | InChI=1S/C15H20F5NO/c1-10-5-6-12(14(16,17)15(18,19)20)13(2,8-10)22-9-11-4-3-7-21-11/h5-6,11,21H,3-4,7-9H2,1-2H3 |
| InChIKey | DCJOJCHPINNYQD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|