C12H12N4O — CID 142854255
5-(4-methoxynaphthalen-1-yl)-2,5-dihydro-1H-tetrazole (PubChem CID 142854255) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 5-(4-methoxynaphthalen-1-yl)-2,5-dihydro-1H-tetrazole.
| Compound Name | 5-(4-methoxynaphthalen-1-yl)-2,5-dihydro-1H-tetrazole |
|---|---|
| PubChem CID | 142854255 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-(4-methoxynaphthalen-1-yl)-2,5-dihydro-1H-tetrazole |
| SMILES | COc1ccc(C2N=NNN2)c2ccccc12 |
| InChI | InChI=1S/C12H12N4O/c1-17-11-7-6-10(12-13-15-16-14-12)8-4-2-3-5-9(8)11/h2-7,12H,1H3,(H,13,16)(H,14,15) |
| InChIKey | UFEMVPWRFQXRFI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |