C23H20F3NO5 — CID 142854761
3-(methylamino)benzoic acid;2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]acetaldehyde (PubChem CID 142854761) has the molecular formula C23H20F3NO5 and a molecular weight of 447.41 g/mol. Its IUPAC name is 3-(methylamino)benzoic acid;2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]acetaldehyde.
| Compound Name | 3-(methylamino)benzoic acid;2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 142854761 |
| Molecular Formula | C23H20F3NO5 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-(methylamino)benzoic acid;2-[4-[4-(trifluoromethyl)phenoxy]phenoxy]acetaldehyde |
| SMILES | CNc1cccc(C(=O)O)c1.O=CCOc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H11F3O3.C8H9NO2/c16-15(17,18)11-1-3-13(4-2-11)21-14-7-5-12(6-8-14)20-10-9-19;1-9-7-4-2-3-6(5-7)8(10)11/h1-9H,10H2;2-5,9H,1H3,(H,10,11) |
| InChIKey | GFPRAJKOLUYDSQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|