C24H34N4O2 — CID 142855540
2-(2-methoxyethylamino)-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]pyridine-4-carboxamide (PubChem CID 142855540) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142855540 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]pyridine-4-carboxamide |
| SMILES | COCCNc1cc(C(=O)NCCN2CCC(CCc3ccccc3)CC2)ccn1 |
| InChI | InChI=1S/C24H34N4O2/c1-30-18-14-26-23-19-22(9-12-25-23)24(29)27-13-17-28-15-10-21(11-16-28)8-7-20-5-3-2-4-6-20/h2-6,9,12,19,21H,7-8,10-11,13-18H2,1H3,(H,25,26)(H,27,29) |
| InChIKey | CATAQKGLGXTEHJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|