C23H30N2O2 — CID 142855670
2-hydroxy-2-phenyl-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]acetamide (PubChem CID 142855670) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-hydroxy-2-phenyl-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]acetamide.
| Compound Name | 2-hydroxy-2-phenyl-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 142855670 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-hydroxy-2-phenyl-N-[2-[4-(2-phenylethyl)piperidin-1-yl]ethyl]acetamide |
| SMILES | O=C(NCCN1CCC(CCc2ccccc2)CC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O2/c26-22(21-9-5-2-6-10-21)23(27)24-15-18-25-16-13-20(14-17-25)12-11-19-7-3-1-4-8-19/h1-10,20,22,26H,11-18H2,(H,24,27) |
| InChIKey | XMMSIKVOPJVXMB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |