C19H22N2O3 — CID 142857951
(E)-5-[[(1Z)-3-methyl-1-(2-oxo-1H-indol-3-ylidene)but-2-en-2-yl]amino]hex-4-enoic acid (PubChem CID 142857951) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (E)-5-[[(1Z)-3-methyl-1-(2-oxo-1H-indol-3-ylidene)but-2-en-2-yl]amino]hex-4-enoic acid.
| Compound Name | (E)-5-[[(1Z)-3-methyl-1-(2-oxo-1H-indol-3-ylidene)but-2-en-2-yl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 142857951 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (E)-5-[[(1Z)-3-methyl-1-(2-oxo-1H-indol-3-ylidene)but-2-en-2-yl]amino]hex-4-enoic acid |
| SMILES | CC(C)=C(/C=C1\C(=O)Nc2ccccc21)N/C(C)=C/CCC(=O)O |
| InChI | InChI=1S/C19H22N2O3/c1-12(2)17(20-13(3)7-6-10-18(22)23)11-15-14-8-4-5-9-16(14)21-19(15)24/h4-5,7-9,11,20H,6,10H2,1-3H3,(H,21,24)(H,22,23)/b13-7+,15-11- |
| InChIKey | GBOFLAQTLZHZOR-SGLMTQOWSA-N |
| XLogP | 3.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|