C20H20N2O3 — CID 142859605
2,5-dimethylisoindole-1,3-dione;2,5-dimethyl-3H-isoindol-1-one (PubChem CID 142859605) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2,5-dimethylisoindole-1,3-dione;2,5-dimethyl-3H-isoindol-1-one.
| Compound Name | 2,5-dimethylisoindole-1,3-dione;2,5-dimethyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 142859605 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2,5-dimethylisoindole-1,3-dione;2,5-dimethyl-3H-isoindol-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)N(C)C2=O.Cc1ccc2c(c1)CN(C)C2=O |
| InChI | InChI=1S/C10H9NO2.C10H11NO/c1-6-3-4-7-8(5-6)10(13)11(2)9(7)12;1-7-3-4-9-8(5-7)6-11(2)10(9)12/h3-5H,1-2H3;3-5H,6H2,1-2H3 |
| InChIKey | GQCPINQNQBJCJO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|