C16H16Br2O3 — CID 142860318
2-[(3,5-dibromo-2-methylphenyl)methyl]-3,5-dimethoxyphenol (PubChem CID 142860318) has the molecular formula C16H16Br2O3 and a molecular weight of 416.11 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-methylphenyl)methyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(3,5-dibromo-2-methylphenyl)methyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 142860318 |
| Molecular Formula | C16H16Br2O3 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2-[(3,5-dibromo-2-methylphenyl)methyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(Cc2cc(Br)cc(Br)c2C)c(OC)c1 |
| InChI | InChI=1S/C16H16Br2O3/c1-9-10(4-11(17)6-14(9)18)5-13-15(19)7-12(20-2)8-16(13)21-3/h4,6-8,19H,5H2,1-3H3 |
| InChIKey | HEWAFRXMTHCKIN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |