C29H28N4O2S2 — CID 142860668
N-[4-[[(5Z)-3-benzyl-5-[[(Z)-2-(dimethylamino)-2-phenylethenyl]sulfanylmethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide (PubChem CID 142860668) has the molecular formula C29H28N4O2S2 and a molecular weight of 528.70 g/mol. Its IUPAC name is N-[4-[[(5Z)-3-benzyl-5-[[(Z)-2-(dimethylamino)-2-phenylethenyl]sulfanylmethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide.
| Compound Name | N-[4-[[(5Z)-3-benzyl-5-[[(Z)-2-(dimethylamino)-2-phenylethenyl]sulfanylmethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 142860668 |
| Molecular Formula | C29H28N4O2S2 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | N-[4-[[(5Z)-3-benzyl-5-[[(Z)-2-(dimethylamino)-2-phenylethenyl]sulfanylmethylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C2\S/C(=C\S/C=C(/c3ccccc3)N(C)C)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H28N4O2S2/c1-21(34)30-24-14-16-25(17-15-24)31-29-33(18-22-10-6-4-7-11-22)28(35)27(37-29)20-36-19-26(32(2)3)23-12-8-5-9-13-23/h4-17,19-20H,18H2,1-3H3,(H,30,34)/b26-19-,27-20-,31-29- |
| InChIKey | FTWLQFRZAXLGEQ-GOWMVNBHSA-N |
| XLogP | 6.54 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|